Synonym: 5-[3-(1,3-Diethylhexahydro-4,6-dioxo-2-thioxo-5-pyrimidinyl)-2-propen-1-ylidene]-1,3-diethyldihydro-2-thioxo-4,6(1H,5H)-pyrimidinedione; Bis(1,3-diethylthiobarbituric acid)trimethine oxonol
CAS Number: 47623-98-3
Empirical Formula (Hill Notation): C19H24N4O4S2
Molecular Weight: 436.55
EC Number: 256-325-5
MDL Number: MFCD07437858
Linear Formula: C19H24N4O4S2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| fluorescence |
λex 535 nm; λem 560 nm in DMSO |
| InChI |
1S/C19H24N4O4S2/c1-5-20-14(24)12(15(25)21(6-2)18(20)28)10-9-11-13-16(26)22(7-3)19(29)23(8-4)17(13)27/h9-12H,5-8H2,1-4H3/b10-9+ |
| InChI key |
VJYNRXFXHKIGLT-MDZDMXLPSA-N |
| Quality Level |
100  |
| SMILES string |
CCN1C(=O)C(C=CC=C2C(=O)N(CC)C(=S)N(CC)C2=O)C(=O)N(CC)C1=S |
| storage temp. |
−20°C |
| suitability |
complies for Infrared spectrum |
| Application: |
DISBAC2(3), Voltage Sensitive Probe is used for single-cell fluorescence imaging of transmembrane conductance and potential change. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352108 |
