D-(−)-Fructose
SIGMA/47739 - BioUltra, ≥99.0% (HPLC)
Synonym: D-Levulose; Fruit sugar
CAS Number: 57-48-7
Empirical Formula (Hill Notation): C6H12O6
Molecular Weight: 180.16
EC Number: 200-333-3
MDL Number: MFCD00148910
Linear Formula: C6H12O6
Product Type: Chemical
| λ | 0.1 M in H2O |
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.0% (HPLC) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | colorless |
| form | solid |
| ign. residue | ≤0.1% (as SO4) |
| impurities | insoluble matter, passes filter test |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11) |
| InChI key | BJHIKXHVCXFQLS-UYFOZJQFSA |
| loss | ≤0.1% loss on drying, 20 °C (HV) |
| mp | 119-122 °C (dec.) (lit.) |
| optical activity | [α]20/D −92±2°, 1 hr, c = 10% in H2O |
| pH | 5.0-7.0 (25 °C, 0.1 M in H2O) |
| product line | BioUltra |
| Quality Level | 100  |
| SMILES string | OC[C@@H](O)[C@@H](O)[C@H] |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| storage temp. | room temp |
| UV absorption | λ: 260 nm Amax: 0.04 |
| λ: 280 nm Amax: 0.04 |
| Application: | D-Fructose is an important monosaccharide used in a wide range of applications. D-fructose is used in carbohydrate research, in organic and bioorganic synthesis; as a model compound; as a reference material, as an enzyme substrate and as a nutrient. |
| Other Notes: | To gain a comprehensive understanding of our extensive range of Monosaccharides for your research, we encourage you to visit our Carbohydrates Category page. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Purity | ≥99.0% (HPLC) |
| mp | 119-122 °C (dec.) (lit.) |
| Storage Temp. | room temp |
| UNSPSC | 12352201 |