D-(+)-Glucose
SIGMA/49139 - BioUltra, anhydrous, ≥99.5% (sum of enantiomers, HPLC)
Synonym: Dextrose
CAS Number: 50-99-7
Empirical Formula (Hill Notation): C6H12O6
Molecular Weight: 180.16
EC Number: 200-075-1
Linear Formula: C6H12O6
Product Type: Chemical
| λ | 1 M in H2O |
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.5% (sum of enantiomers, HPLC) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | white |
| form | powder |
| grade | anhydrous |
| ign. residue | ≤0.1% (as SO4) |
| impurities | insoluble matter, passes filter test |
| InChI | 1S/C6H12O6/c7-1-2-3(8)4(9 |
| InChI key | WQZGKKKJIJFFOK-DVKNGEFBSA |
| loss | ≤0.1% loss on drying, 20 °C (HV) |
| mp | 150-152 °C (lit.) |
| optical activity | [α]20/D +53±2°, 3 hr, c = 10% in H2O |
| pH | 5.0-7.0 (25 °C, 1 M in H2O) |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | OC[C@H]1O[C@H](O)[C@H](O) |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| storage temp. | room temp |
| UV absorption | λ: 260 nm Amax: 0.10 |
| λ: 280 nm Amax: 0.10 |
| Other Notes: | Neutralizes growth inhibition by myxothiazol in Saccharomyces cerevisiae, Mucor hiemalis and Candida albicans; Component of the liquid stationary phase in the GLC separation of nitroxylene and xylenol isomers |
| Other Notes: | To gain a comprehensive understanding of our extensive range of Monosaccharides for your research, we encourage you to visit our Carbohydrates Category page. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.5% (sum of enantiomers, HPLC) |
| mp | 150-152 °C (lit.) |
| Storage Temp. | room temp |
| UNSPSC | 12352201 |