Glucose solution
SIGMA/49163 - BioUltra, Molecular Biology, ~20% in H2O
CAS Number: 492-62-6
Empirical Formula (Hill Notation): C6H12O6
Molecular Weight: 180.16
MDL Number: MFCD00063774
Linear Formula: C6H12O6
Product Type: Chemical
| λ | neat |
| cation traces | Al: ≤1 mg/kg |
| Ba: ≤1 mg/kg | |
| Bi: ≤1 mg/kg | |
| Ca: ≤5 mg/kg | |
| Cd: ≤1 mg/kg | |
| Co: ≤1 mg/kg | |
| Cr: ≤1 mg/kg | |
| Cu: ≤1 mg/kg | |
| Fe: ≤1 mg/kg | |
| K: ≤20 mg/kg | |
| Li: ≤1 mg/kg | |
| Mg: ≤1 mg/kg | |
| Mn: ≤1 mg/kg | |
| Mo: ≤1 mg/kg | |
| Na: ≤20 mg/kg | |
| Ni: ≤1 mg/kg | |
| Pb: ≤1 mg/kg | |
| Sr: ≤1 mg/kg | |
| Zn: ≤1 mg/kg | |
| concentration | ~20% in H2O |
| form | liquid |
| grade | Molecular Biology |
| impurities | DNases, none detected |
| insoluble matter, passes filter test | |
| phosphatases, none detected | |
| proteases, none detected | |
| RNases, none detected | |
| InChI | 1S/C6H12O6/c7-1-2-3(8)4(9 |
| InChI key | WQZGKKKJIJFFOK-DVKNGEFBSA |
| pH | 5.0-8.0 (25 °C) |
| product line | BioUltra |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | OC[C@H]1O[C@H](O)[C@H](O) |
| storage temp. | room temp |
| UV absorption | λ: 260 nm Amax: ≤0.10 |
| λ: 280 nm Amax: ≤0.10 |
| Application: | D-(+)-Glucose is a common natural sugar involved in processes such as energy production, glycosylation, and formation of glycans that provide structure to cells. Glucose is involved in a detrimentatl process in cells called glycation. Glucose is used as a supplement for cell culture and in numerous cellular processes and molecular biology applications. |
| Other Notes: | To gain a comprehensive understanding of our extensive range of Monosaccharides for your research, we encourage you to visit our Carbohydrates Category page. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Refractive Index | n |
| Storage Temp. | room temp |
| UNSPSC | 12352201 |