Glucose solution
SIGMA/49163 - BioUltra, for molecular biology, ~20% in H2O
CAS Number: 492-62-6
Empirical Formula (Hill Notation): C6H12O6
Molecular Weight: 180.16
MDL Number: MFCD00063774
Linear Formula: C6H12O6
Product Type: Chemical
λ | neat |
cation traces | Al: ≤1 mg/kg |
Ba: ≤1 mg/kg | |
Bi: ≤1 mg/kg | |
Ca: ≤5 mg/kg | |
Cd: ≤1 mg/kg | |
Co: ≤1 mg/kg | |
Cr: ≤1 mg/kg | |
Cu: ≤1 mg/kg | |
Fe: ≤1 mg/kg | |
K: ≤20 mg/kg | |
Li: ≤1 mg/kg | |
Mg: ≤1 mg/kg | |
Mn: ≤1 mg/kg | |
Mo: ≤1 mg/kg | |
Na: ≤20 mg/kg | |
Ni: ≤1 mg/kg | |
Pb: ≤1 mg/kg | |
Sr: ≤1 mg/kg | |
Zn: ≤1 mg/kg | |
concentration | ~20% in H2O |
form | liquid |
grade | for molecular biology |
impurities | DNases, none detected |
insoluble matter, passes filter test | |
phosphatases, none detected | |
proteases, none detected | |
RNases, none detected | |
InChI | 1S/C6H12O6/c7-1-2-3(8)4(9 |
InChI key | WQZGKKKJIJFFOK-DVKNGEFBSA |
pH | 5.0-8.0 (25 °C) |
product line | BioUltra |
Quality Level | 100 |
refractive index | n |
SMILES string | OC[C@H]1O[C@H](O)[C@H](O) |
storage temp. | room temp |
UV absorption | λ: 260 nm Amax: ≤0.10 |
λ: 280 nm Amax: ≤0.10 |
Application: | D-(+)-Glucose is a common natural sugar involved in processes such as energy production, glycosylation, and formation of glycans that provide structure to cells. Glucose is involved in a detrimentatl process in cells called glycation. Glucose is used as a supplement for cell culture and in numerous cellular processes and molecular biology applications. |
Other Notes: | To gain a comprehensive understanding of our extensive range of Monosaccharides for your research, we encourage you to visit our Carbohydrates Category page. |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 1 |
Flash Point(F) | Not applicable |
Flash Point(C) | Not applicable |
Refractive Index | n |
Storage Temp. | room temp |
UNSPSC | 12352201 |