Synonym: (1aS,1bS,2S,5aR,6S,6aS)-1a,1b,2,5a,6,6a-Hexahydro-6-hydroxy-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl-β-D-glucopyranoside; Catalpinoside; De(p-hydroxybenzoyl)catalposide
CAS Number: 2415-24-9
Empirical Formula (Hill Notation): C15H22O10
Molecular Weight: 362.33
EC Number: 219-324-0
MDL Number: MFCD11111524
Linear Formula: C15H22O10
Product Type: Chemical
| assay |
≥96% (HPLC) |
| InChI |
1S/C15H22O10/c16-3-6-9(19)10(20)11(21)14(23-6)24-13-7-5(1-2-22-13)8(18)12-15(7,4-17)25-12/h1-2,5-14,16-21H,3-4H2/t5-,6-,7-,8+,9-,10+,11-,12+,13+,14+,15-/m1/s1 |
| InChI key |
LHDWRKICQLTVDL-PZYDOOQISA-N |
| Quality Level |
100  |
| SMILES string |
OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@H]3[C@H](O)[C@@H]4O[C@]4(CO)[C@@H]23)[C@H](O)[C@@H](O)[C@@H]1O |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
The primary function is to stimulate the production of adrenal cortical hormones, which increases the production of sex hormones. Catalpol also exhibits anti-inflammatory activity and has shown to increase the production of androgens yielded by the adrenal gland, which can lead to increases in muscle mass. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| Purity |
≥96% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352211 |