Histamine dihydrochloride
SIGMA/53300 - ≥99.0% (AT)
Synonym: 2-
CAS Number: 56-92-8
Empirical Formula (Hill Notation): C5H9N3 · 2HCl
Molecular Weight: 184.07
EC Number: 200-298-4
MDL Number: MFCD00012703
Linear Formula: C5H9N3 · 2HCl
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 53300-25G
| anion traces | sulfate (SO42-): ≤200 ppm |
| assay | ≥99.0% (AT) |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| form | powder or crystals |
| ign. residue | ≤0.2% |
| InChI | 1S/C5H9N3.2ClH/c6-2-1-5-3 |
| InChI key | PPZMYIBUHIPZOS-UHFFFAOYSA |
| loss | ≤0.2% loss on drying, 20 °C (HV) |
| mp | 244-247 °C |
| 249-252 °C (lit.) | |
| SMILES string | Cl[H].Cl[H].NCCc1c[nH]cn1 |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| Biochem/physiol Actions: | Histamine dihydrochloride has been shown to activate nitric oxide synthetase and suppress or inhibit the generation of reactive oxygen species (ROS). Inhibition of ROS by histamine dihydrochloride allows activation of T cells and NK cells by IL-2. In a rat model, histamine dihydrochloride suppressed ROS generated by Kupffer cells through the H2 histamine receptor. |
| General description: | Histamine is a hydrophilic amine derived from the decarboxylation of histidine by the enzyme L-histidine decarboxylase. Histamine has been shown to play a role in many physiological processes such as gastric secretion, neurotransmission, immune response, vasodialation, and inflammation. Additionally, studies have reported a role for histamine dihydrochloride with interleukin-2 (IL-2) in treatment of acute myeloid leukemia and in protection against alcohol-induced liver injury in rats. |
| Other Notes: | Substrate for the assay of histamine-N-methyltransfe |
| Packaging: | 1, 5, 25 g in glass bottle |
| Symbol |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315 - H317 - H319 - H334 - H335 |
| Precautionary statements | P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-42/43 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (AT) |
| mp | 244-247 °C; 249-252 °C (lit.) |
| UNSPSC | 12352116 |