Synonym: (3S,3′S,5R,5′R,6R,6′S,9′-cis)-6,7-Didehydro-5′,6′-epoxy-5′,6′-dihydro-β,β-carotene-3,3′,5(6H)-triol; 9′-cis-Neoxanthin
CAS Number: 14660-91-4
Empirical Formula (Hill Notation): C40H56O4
Molecular Weight: 600.87
MDL Number: MFCD31631139
Linear Formula: C40H56O4
Product Type: Chemical
| λ |
in ethanol |
| assay |
≥90% (HPLC) |
| form |
solid |
| InChI |
1S/C40H56O4/c1-29(17-13-19-31(3)21-22-35-36(5,6)25-33(41)27-38(35,9)43)15-11-12-16-30(2)18-14-20-32(4)23-24-40-37(7,8)26-34(42)28-39(40,10)44-40/h11-21,23-24,33-34,41-43H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,24-23+,29-15+,30-16+,31-19+,32-20+/t22?,33-,34-,38+,39+,40-/m0/s1 |
| InChI key |
PGYAYSRVSAJXTE-CLONMANBSA-N |
| Quality Level |
100  |
| SMILES string |
C/C(C([H])=[C@]=C1[C@](C)(O)C[C@@H](O)CC1(C)C)=CC=CC(C)=CC=CC=C(C)C=CC=C(/C=C/[C@@]2(O3)[C@@]3(C)C[C@@H](O)CC2(C)C)C |
| storage temp. |
−20°C |
| UV absorption |
λ: 435-439 nm Amax |
| Application: |
Neoxanthin has been used as a reference standard to determine the phenolic content and antioxidant activity of Phaeodactylum tricornutum extracts by high-performance liquid chromatography (HPLC). |
| Biochem/physiol Actions: |
Neoxanthin is an allenic xanthophyll and one of the major carotenoids found in plants such as spinach and barley leaves. A trace amount of this pigment is also found in olive oil. Neoxanthin exists as two geometric isomers such as trans-neoxanthin and 9′-cis-neoxanthin. It acts as a precursor of abscisic acid. It plays a role in photoprotection by providing general antioxidant activity. Neoxanthin exhibits apoptotic and anti-proliferative effects. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥90% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352202 |