trans-4-Hydroxy-L-proline
SIGMA/56250 - BioXtra, ≥99.0% (NT)
Synonym: (2S,4R)
CAS Number: 51-35-4
Empirical Formula (Hill Notation): C5H9NO3
Molecular Weight: 131.13
EC Number: 200-091-9
MDL Number: MFCD00064320
Linear Formula: C5H9NO3
Product Type: Chemical
| anion traces | chloride (Cl-): ≤100 mg/kg |
| sulfate (SO42-): ≤100 mg/kg | |
| application(s) | peptide synthesis |
| assay | ≥99.0% (NT) |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| NH4+: ≤100 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | colorless to white |
| form | solid |
| ign. residue | ≤0.1% (as SO4) |
| impurities | ≤0.3% foreign amino acids |
| InChI | 1S/C5H9NO3/c7-3-1-4(5(8)9 |
| InChI key | PMMYEEVYMWASQN-DMTCNVIQSA |
| loss | ≤0.1% loss on drying, 110 °C |
| mp | 273 °C (dec.) (lit.) |
| optical activity | [α]20/D −76.0±1.5°, c = 5% in H2O |
| product line | BioXtra |
| Quality Level | 100  |
| SMILES string | O[C@H]1CN[C@@H](C1)C(O)=O |
| Biochem/physiol Actions: | Trans-4-Hydroxy-L-proline is used as a starting material in the synthesis of (-)-secrinine; the synthesis of prolinol-based nucleotide analogues with N-phosphonomethyl moiety attached to the nitrogen atom of prolinol ring and in asymmetric synthesis of the ABC-ring system of the antitumor antibiotic MPC1001. |
| Biochem/physiol Actions: | Trans-4-Hydroxy-L-proline is used in the organic synthesis of depsilairdin analogues, noncompetitive peptidomimetic inhibitors of multidrug resistance P-glycoprotein and 3-guaninyl-5-hydroxymethy |
| Other Notes: | Enzymes and intermediates of hydroxyproline degradation |
| Other Notes: | Natural constituent of animal structural proteins such as collagen and elastin. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Purity | ≥99.0% (NT) |
| mp | 273 °C (dec.) (lit.) |
| UNSPSC | 12352209 |