N-Lauroylsarcosine sodium salt
SIGMA/61743 - BioUltra, Molecular Biology, ≥99.0% (HPLC)
Synonym: N-lauroylsarcosine sodium salt; N-Dodecanoyl-N-methylglycine sodium salt; Sarkosyl NL
CAS Number: 137-16-6
Empirical Formula (Hill Notation): C15H28NNaO3
Molecular Weight: 293.38
EC Number: 205-281-5
MDL Number: MFCD00042728
Linear Formula: CH3(CH2)10CON(CH3)CH2COONa
Product Type: Chemical
| λ | 1 M in H2O |
| aggregation number | 2 |
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| application(s) | sample preservation |
| assay | ≥99.0% (HPLC) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| CMC | 14.6 mM (20-25°C) |
| description | anionic |
| form | powder |
| grade | Molecular Biology |
| impurities | DNases, none detected |
| insoluble matter, passes filter test | |
| phosphatases, none detected | |
| proteases, none detected | |
| RNases, none detected | |
| InChI | 1S/C15H29NO3.Na/c1-3-4-5- |
| InChI key | KSAVQLQVUXSOCR-UHFFFAOYSA |
| loss | ≤1% loss on drying, 110 °C |
| mol wt | average mol wt 600 |
| micellar avg mol wt 600 | |
| pH | 7.0-9.0 (25 °C, 1 M in H2O) |
| product line | BioUltra |
| Quality Level | 200 ![]() |
| SMILES string | [Na+].CCCCCCCCCCCC(=O)N(C |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| UV absorption | λ: 260 nm Amax: 0.2 |
| λ: 280 nm Amax: 0.06 |
| Application: | N-Lauroylsarcosine sodium salt has been used as a component: • of nuclease stop mix, embryo extract buffer to dissociate nonspecifically bound proteins from chromatin • of proteinase K solution for the heat denaturation of genomic DNA • of 10% (w/v) sarcosyl/0.5 M ethylenediaminetetraaceti • in the hybridization buffer for in situ hybridization histochemistry • in the embryo extract buffer to dissociate nonspecifically bound proteins from chromatin • in proteinase K solution to inactivate the enzymes |
| General description: | The N-lauroylsarcosine sodium salt is applicable for processes that require tight control of elemental content. This product aids in the solubilization and separation of membrane proteins, glycoproteins, and the isolation of RNA and plasmids. N-lauroylsarcosine sodium salt serves as an antifoaming supplement or as a component of a lysing buffer of bacteria or other cells. It indicates the paramagnetic anisotropy sign change in the micelle mesophase. N-lauroylsarcosine sodium salt inhibits hexokinase and the bacterial flora of human saliva/gut at 0.25%. It also exhibits fungistatic activity in aqueous dispersion (1%). N-lauroylsarcosine (LS) is an anionic surfactant with protein denaturant potency that is structurally similar to sodium lauryl sulfate (SLS). It can inactivate herpes simplex virus (HSV) infectivity in vitro. It is used as a microbicide in topical vaginal formulations to block the transmission of HSV, human immunodeficiency virus type 1 (HIV-1), and possibly other pathogens causing sexually transmitted diseases (STDs). |
| Other Notes: | Anionic surfactant. |
| Symbol | ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H315 - H318 - H330 |
| Precautionary statements | P280 - P302 + P352 - P304 + P340 + P310 - P305 + P351 + P338 + P310 |
| Hazard Codes | T |
| Risk Statements | 23-38-41 |
| Safety Statements | 22-26-37/39-38-45 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | WGK 1 |
| Purity | ≥99.0% (HPLC) |
| UNSPSC | 12161900 |



