Synonym: (Trimethylammonio)monobromobimane; 5-(Bromomethyl)-N,N,N,2,6-pentamethyl-1,7-dioxo-1H,7H-pyrazolo[1,2-a]pyrazole-3-methanaminium bromide; Brombimane q; Thiolye MQ; qBBr
CAS Number: 71418-45-6
Empirical Formula (Hill Notation): C13H19Br2N3O2
Molecular Weight: 409.12
MDL Number: MFCD00036953
Linear Formula: C13H19Br2N3O2
Product Type: Chemical
| assay |
≥90.0% (HPLC) |
| fluorescence |
λex 380 nm; λem 475 nm in 0.1 M phosphate pH 7.5 |
| form |
powder |
| InChI |
1S/C13H19BrN3O2.BrH/c1-8-10(6-14)15-11(7-17(3,4)5)9(2)13(19)16(15)12(8)18;/h6-7H2,1-5H3;1H/q+1;/p-1 |
| InChI key |
FCRPMMVPBVOKQS-UHFFFAOYSA-M |
| Quality Level |
100  |
| SMILES string |
[Br-].CC1=C(CBr)N2N(C1=O)C(=O)C(C)=C2C[N+](C)(C)C |
| solubility |
DMSO: 5 mg/mL |
| storage temp. |
2-8°C |
| suitability |
suitable for fluorescence |
| Biochem/physiol Actions: |
Monobromobimanes are essentially nonfluorescent until conjugated and readily react with low molecular weight thiols. Unlike common monobromobimanes, this carries a positive charge, thus permitting separation of conjugates by electrophoresis or cation-exchange chromatography |
| Other Notes: |
Reagent for labeling thiols in biol. materials |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥90.0% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12171500 |
