Sodium phosphate monobasic monohydrate
SIGMA/71507 - BioXtra, for molecular biology, ≥99.5% (T)
Synonym: Monosodium phosphate; Sodium dihydrogen phosphate monohydrate
CAS Number: 10049-21-5
Empirical Formula (Hill Notation): H2NaO4P · H2O
Molecular Weight: 137.99
EC Number: 231-449-2
MDL Number: MFCD00149208
Linear Formula: NaH2PO4 · H2O
Product Type: Chemical
λ | 1 M in H2O |
anion traces | chloride (Cl-): ≤5 mg/kg |
sulfate (SO42-): ≤30 mg/kg | |
assay | ≥99.5% (T) |
cation traces | Al: ≤5 mg/kg |
As: ≤0.1 mg/kg | |
Ba: ≤5 mg/kg | |
Bi: ≤5 mg/kg | |
Ca: ≤10 mg/kg | |
Cd: ≤5 mg/kg | |
Co: ≤5 mg/kg | |
Cr: ≤5 mg/kg | |
Cu: ≤5 mg/kg | |
Fe: ≤5 mg/kg | |
K: ≤50 mg/kg | |
Li: ≤5 mg/kg | |
Mg: ≤5 mg/kg | |
Mn: ≤5 mg/kg | |
Mo: ≤5 mg/kg | |
Ni: ≤5 mg/kg | |
Pb: ≤5 mg/kg | |
Sr: ≤5 mg/kg | |
Zn: ≤5 mg/kg | |
form | crystals |
grade | for molecular biology |
impurities | DNases, none detected |
insoluble matter, passes filter test | |
phosphatases, none detected | |
proteases, none detected | |
RNases, none detected | |
≤0.001% total nitrogen (N) | |
InChI | 1S/Na.H3O4P.H2O/c;1-5(2,3 |
InChI key | BBMHARZCALWXSL-UHFFFAOYSA |
pH | 4.0-4.5 (25 °C, 1 M in H2O) |
product line | BioXtra |
Quality Level | 200 |
SMILES string | [Na+].[H]O[H].OP(O)([O-]) |
solubility | H2O: 1 M, clear, colorless |
UV absorption | λ: 260 nm Amax: ≤0.03 |
λ: 280 nm Amax: ≤0.02 |
Application: | Sodium phosphate monobasic monohydrate has been used as a component of phosphate buffer to maintain the pH for the preparation of collagen gels and matrices. |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 3 |
Flash Point(F) | Not applicable |
Flash Point(C) | Not applicable |
Purity | ≥99.5% (T) |
UNSPSC | 12161700 |