Synonym: 4-(6-Acetoxymethoxy-2,7-dichloro-3-oxo-9-xanthenyl)-4′-methyl-2,2′(ethylenedioxy)dianiline-N,N,N′,N′-tetraacetic acid tetrakis(acetoxymethyl) ester
CAS Number: 121714-22-5
Empirical Formula (Hill Notation): C51H50Cl2N2O23
Molecular Weight: 1129.85
MDL Number: MFCD28143734
Linear Formula: C51H50Cl2N2O23
Product Type: Chemical
| assay |
≥90% (TLC) |
| fluorescence |
λex 506 nm; λem 525 nm in 0.1 M Tris pH 8.0, esterase |
| form |
powder |
| InChI |
1S/C51H50Cl2N2O23/c1-28-7-9-39(54(19-47(62)74-24-69-30(3)57)20-48(63)75-25-70-31(4)58)45(13-28)66-11-12-67-46-14-34(8-10-40(46)55(21-49(64)76-26-71-32(5)59)22-50(65)77-27-72-33(6)60)51-35-15-37(52)41(61)17-42(35)78-43-18-44(38(53)16-36(43)51)73-23-68-29(2 |
| InChI key |
PTPUOMXKXCCSEN-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CC(=O)OCOC(=O)CN(CC(=O)OCOC(C)=O)c1ccc(C)cc1OCCOc2cc(ccc2N(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O)C3=C4C=C(Cl)C(=O)C=C4Oc5cc(OCOC(C)=O)c(Cl)cc35 |
| storage temp. |
−20°C |
| Application: |
Cell permeable fluorescent indicator of intracellular Ca2+; non-fluorescent until it is hydrolyzed intracellularly and/or in the presence of Ca2+; lower binding affinity allows measurement of higher peaks of Ca2+ transients than with Fura 2. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥90% (TLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12171500 |
