Synonym: (2S,4aR,6aR,7R,9S,10aS,10bR)-2-(3-Furanyl)dodecahydro-9-hydroxy-6a,10b-dimethyl-4,10-dioxo 2H-naphtho[2,1-c]pyran-7-carboxylic acid methyl ester; Divinorin B
CAS Number: 92545-30-7
Empirical Formula (Hill Notation): C21H26O7
Molecular Weight: 390.43
MDL Number: MFCD16036232
Linear Formula: C21H26O7
Product Type: Chemical
| assay |
≥93.0% (HPLC) |
| drug control |
regulated under CDSA - not available from Sigma-Aldrich Canada |
| form |
powder or crystals |
| InChI |
1S/C21H26O7/c1-20-6-4-12-19(25)28-15(11-5-7-27-10-11)9-21(12,2)17(20)16(23)14(22)8-13(20)18(24)26-3/h5,7,10,12-15,17,22H,4,6,8-9H2,1-3H3/t12-,13-,14-,15-,17-,20-,21-/m0/s1 |
| InChI key |
BLTMVAIOAAGYAR-CEFSSPBYSA-N |
| Quality Level |
100  |
| SMILES string |
COC(=O)[C@@H]1C[C@H](O)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)c4ccoc4 |
| solubility |
chloroform: soluble |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Salvinorin B is the major deacetylated metabolite of salvinorin A, a diterpene from Salvia divinorum with reported psychotropic activity, not observed in Salvinorin B. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥93.0% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352204 |
