Synonym: 1-[(2β,3α,5α,16β,17β)-3,17-Bis(acetyloxy)-2-(1-piperidinyl)androstan-16-yl]-1-methyl-piperidinium bromide
CAS Number: 50700-72-6
Empirical Formula (Hill Notation): C34H57BrN2O4
Molecular Weight: 637.73
EC Number: 256-723-9
MDL Number: MFCD00867762
Linear Formula: C34H57BrN2O4
Product Type: Chemical
| assay |
≥97.0% (TLC) |
| biological source |
synthetic |
| form |
powder or crystals |
| functional group |
carboxylic acid |
| InChI |
1S/C34H57N2O4.BrH/c1-23(37)39-31-20-25-12-13-26-27(34(25,4)22-29(31)35-16-8-6-9-17-35)14-15-33(3)28(26)21-30(32(33)40-24(2)38)36(5)18-10-7-11-19-36;/h25-32H,6-22H2,1-5H3;1H/q+1;/p-1/t25-,26+,27-,28-,29-,30-,31-,32-,33-,34-;/m0./s1 |
| InChI key |
VEPSYABRBFXYIB-PWXDFCLTSA-M |
| Quality Level |
100  |
| SMILES string |
[Br-].CC(=O)O[C@H]1C[C@@H]2CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3C[C@@H]([C@@H]4OC(C)=O)[N+]5(C)CCCCC5)[C@@]2(C)C[C@@H]1N6CCCCC6 |
| Biochem/physiol Actions: |
Vecuronium Bromide is an aminosteroidal neuromuscular blocking agent. It relaxes the skeletal muscle and decreases oxygen consumption during surgery. It competes with acetylcholine and bind to cholinergic receptors at neuromuscular junctions. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.0% (TLC) |
| UNSPSC |
51152000 |
