Synonym: 1,4-Piperazinediethanesulfonic acid; Piperazine-1,4-bis(2-ethanesulfonic acid); Piperazine-N,N′-bis(2-ethanesulfonic acid)
CAS Number: 5625-37-6
Empirical Formula (Hill Notation): C8H18N2O6S2
Molecular Weight: 302.37
EC Number: 227-057-6
MDL Number: MFCD00006159
Linear Formula: C8H18N2O6S2
Product Type: Chemical
| λ |
0.1 M in 1 M NaOH |
| anion traces |
chloride (Cl-): ≤200 mg/kg |
| |
sulfate (SO42-): ≤50 mg/kg |
| assay |
≥99.5% (T) |
| cation traces |
Al: ≤5 mg/kg |
| |
As: ≤0.1 mg/kg |
| |
Ba: ≤5 mg/kg |
| |
Bi: ≤5 mg/kg |
| |
Ca: ≤10 mg/kg |
| |
Cd: ≤5 mg/kg |
| |
Co: ≤5 mg/kg |
| |
Cr: ≤5 mg/kg |
| |
Cu: ≤5 mg/kg |
| |
Fe: ≤5 mg/kg |
| |
K: ≤50 mg/kg |
| |
Li: ≤5 mg/kg |
| |
Mg: ≤5 mg/kg |
| |
Mn: ≤5 mg/kg |
| |
Mo: ≤5 mg/kg |
| |
Na: ≤100 mg/kg |
| |
Ni: ≤5 mg/kg |
| |
Pb: ≤5 mg/kg |
| |
Sr: ≤5 mg/kg |
| |
Zn: ≤5 mg/kg |
| form |
powder |
| grade |
for molecular biology |
| ign. residue |
≤0.2% (as SO4) |
| impurities |
DNases, none detected |
| |
insoluble matter, passes filter test |
| |
phosphatases, none detected |
| |
proteases, none detected |
| |
RNases, none detected |
| InChI |
1S/C8H18N2O6S2/c11-17(12,13)7-5-9-1-2-10(4-3-9)6-8-18(14,15)16/h1-8H2,(H,11,12,13)(H,14,15,16) |
| InChI key |
IHPYMWDTONKSCO-UHFFFAOYSA-N |
| loss |
≤0.2% loss on drying, 110 °C |
| mp |
>300 °C (lit.) |
| pKa (25 °C) |
6.8 |
| product line |
BioXtra |
| Quality Level |
100  |
| SMILES string |
OS(=O)(=O)CCN1CCN(CC1)CCS(O)(=O)=O |
| solubility |
0.1 M NaOH: 0.1 M at 20 °C, clear, colorless |
| useful pH range |
6.1-7.5 |
| UV absorption |
λ: 260 nm Amax: 0.055 |
| |
λ: 280 nm Amax: 0.040 |
| Application: |
- Sensitive Detection of Immunoglobulin G Stability Using in Real-Time Isothermal Differential Scanning Fluorimetry: Determinants of Protein Stability for Antibody-Based Therapeutics.: The use of PIPES buffer in this study was integral to maintaining the stability of immunoglobulin G during differential scanning fluorimetry. This method is crucial for evaluating the stability of antibody-based therapeutics (Moggridge et al., 2017
 ).
|
| Other Notes: |
Hybrid selection of mRNA - component of prehybridization buffer |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99.5% (T) |
| mp |
>300 °C (lit.) |
| UNSPSC |
12161700 |
