D-Sorbitol
SIGMA/85529 - BioUltra, ≥99.0% (HPLC)
Synonym: D-Glucitol
CAS Number: 50-70-4
Empirical Formula (Hill Notation): C6H14O6
Molecular Weight: 182.17
EC Number: 200-061-5
MDL Number: MFCD00004708
Linear Formula: C6H14O6
Product Type: Chemical
| λ | 1 M in H2O |
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.0% (HPLC) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | colorless |
| form | powder |
| ign. residue | ≤0.1% (as SO4) |
| impurities | insoluble matter, passes filter test |
| InChI | 1S/C6H14O6/c7-1-3(9)5(11) |
| InChI key | FBPFZTCFMRRESA-JGWLITMVSA |
| loss | ≤0.5% loss on drying, 20 °C (HV) |
| mp | 98-100 °C (lit.) |
| optical activity | [α]20/D −1.5±0.3°, c = 10% in H2O |
| pH | 5.0-7.0 (25 °C, 1 M in H2O) |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | OC[C@@H](O)[C@@H](O)[C@H] |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| UV absorption | λ: 260 nm Amax: 0.04 |
| λ: 280 nm Amax: 0.045 | |
| vapor density | <1 (vs air) |
| vapor pressure | <0.1 mmHg ( 25 °C) |
| Application: | May be used for washing spheroplasts and in isoelectric focusing to minimize endoosmotic flow in agarose gels. May be used to induce osmotic stress. |
| Application: | Sorbitol is a sugar alcohol and slowly metabolized sweetener. Sorbitol, a bacterial culture supplement, is used for the preparation of selective plating media to culture Sorbitol-fermenting bacteria including strains of Escherichia coli and Yersinia enterocolitica. |
| Biochem/physiol Actions: | D-Sorbitol is a sugar alcohol that is commonly used as a sugar substitute. It occurs naturally and is also produced synthetically from glucose. The food industry uses D-sorbitol as an additive in the form of a sweetener, humectant, emulsifier, thickener, or dietary supplement. D-Sorbitol has also been found in cosmetics, paper, and pharmaceuticals. Naturally, D-sorbitol occurs widely in plants via photosynthesis, ranging from algae to higher order fruits of the family Rosaceae. Allelic variation of the Tas1r3 gene affects behavioral taste responses to this sugar alcohol, suggesting that it is a T1R3 receptor ligand. |
| Other Notes: | A plasmolyticum that reversibly inhibits the phenylalanine ammonia-lyase activity of protoplasts at concentrations exceeding 50 mM; Synchronization of Plasmodium falciparum erythrocytic stages in culture; Increases fungal α-amylase thermostability. |
| Other Notes: | To gain a comprehensive understanding of our extensive range of Sugar alcohols for your research, we encourage you to visit our Carbohydrates Category page. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (HPLC) |
| mp | 98-100 °C (lit.) |
| UNSPSC | 12352201 |