Tetramethylrhodamine ethyl ester perchlorate
SIGMA/87917 - suitable for fluorescence, ≥90% (HPCE)
Synonym: TMRE; TMRE perchlorate; TMRE
CAS Number: 115532-52-0
Empirical Formula (Hill Notation): C26H27ClN2O7
Molecular Weight: 514.95
MDL Number: MFCD00467973
Linear Formula: C26H27ClN2O7
Product Type: Chemical
| assay | ≥90% (HPCE) |
| fluorescence | λex 540 nm; λem 595 nm in DMSO |
| form | solid |
| InChI | 1S/C26H27N2O3.ClHO4/c1-6- |
| InChI key | NBAOBNBFGNQAEJ-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | [O-]Cl(=O)(=O)=O.CCOC(=O) |
| solubility | alcohols: soluble |
| DMSO: soluble | |
| storage temp. | 2-8°C |
| suitability | suitable for fluorescence |
| Application: | Tetramethylrhodamine ethyl ester perchlorate (TMRE) is used to study the effects of high glucose in inducing mitochondrial morphology and metabolic changes. TMRE perchlorate is also used to study Fullerene C 60 penetration into Leukemic Cells and the subsequent photoinduced Cytotoxic Effects. |
| General description: | Tetramethylrhodamine ethyl ester perchlorate (TMRE), also known as TMRE perchlorate, is a potential mitochondrial dye. TMRE staining process is reversible, and it doesn’t affect cell proliferation and viability. The sorted cells containing TMRE perchlorate don’t interfere with the subsequent functional assays and hence are a preferred choice for the enrichment of functionally active, unbiased cell populations. |
| Other Notes: | Potential-sensitive probe for measuring membrane potential changes in mitochondria |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H332 - H315 - H319 |
| Precautionary statements | P261 - P264 - P301 + P312 - P302 + P352 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/22-36/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥90% (HPCE) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352116 |


