Synonym: 3,3′-(3,3′-Dimethoxy[1,1′-biphenyl]-4,4′-diyl)-bis(2,5-diphenyl-2H-tetrazolium) dichloride; 3,3′-Dianisole-4,4′-bis(3,5-diphenyltetrazolium chloride); BTC; Blue Tetrazolium chloride; TZ
CAS Number: 1871-22-3
Empirical Formula (Hill Notation): C40H32Cl2N8O2
Molecular Weight: 727.64
EC Number: 217-488-8
MDL Number: MFCD00040933
Linear Formula: C40H32Cl2N8O2
Product Type: Chemical
| application(s) |
microbiology |
| assay |
≥90% (T) |
| form |
powder |
| grade |
indicator for germination |
| InChI |
1S/C40H32N8O2.2ClH/c1-49-37-27-31(23-25-35(37)47-43-39(29-15-7-3-8-16-29)41-45(47)33-19-11-5-12-20-33)32-24-26-36(38(28-32)50-2)48-44-40(30-17-9-4-10-18-30)42-46(48)34-21-13-6-14-22-34;;/h3-28H,1-2H3;2*1H/q+2;;/p-2 |
| InChI key |
MUUHXGOJWVMBDY-UHFFFAOYSA-L |
| mp |
255 °C (dec.) (lit.) |
| Quality Level |
200  |
| SMILES string |
[Cl-].[Cl-].COc1cc(ccc1-[n+]2nc(nn2-c3ccccc3)-c4ccccc4)-c5ccc(c(OC)c5)-[n+]6nc(nn6-c7ccccc7)-c8ccccc8 |
| solubility |
methanol: 0.5 g/10 mL ( hot) |
| Other Notes: |
Used in the assay of reducing sugars; Used in the preparation of DNA-cation complexes, immunoadsorbents for anti-DNA antibodies. |
| Symbol |
 GHS08 |
| Signal word |
Danger |
| Hazard statements |
H350 |
| Precautionary statements |
P201 - P308 + P313 |
| Hazard Codes |
T |
| Risk Statements |
45 |
| Safety Statements |
53-45 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥90% (T) |
| mp |
255 °C (dec.) (lit.) |
| UNSPSC |
12352204 |
