Triethylammonium phosphate solution
SIGMA/90362 - BioXtra, 1 M in H2O
Synonym: Buffer solution 1 M pH 3.0; TEAP
MDL Number: MFCD00067475
Product Type: Chemical
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| application(s) | diagnostic assay manufacturing |
| cation traces | Ca: ≤5 mg/kg |
| Cd: ≤1 mg/kg | |
| Co: ≤1 mg/kg | |
| Cr: ≤1 mg/kg | |
| Cu: ≤1 mg/kg | |
| Fe: ≤1 mg/kg | |
| K: ≤20 mg/kg | |
| Mg: ≤1 mg/kg | |
| Mn: ≤1 mg/kg | |
| Na: ≤20 mg/kg | |
| Ni: ≤1 mg/kg | |
| Pb: ≤1 mg/kg | |
| Zn: ≤1 mg/kg | |
| concentration | 1 M in H2O |
| density | 1.05 g/mL at 20 °C |
| form | liquid |
| InChI | 1S/C6H15N.H3O4P/c1-4-7(5- |
| InChI key | UNXNGGMLCSMSLH-UHFFFAOYSA |
| pH | 2.9-3.1 (25 °C) |
| product line | BioXtra |
| Quality Level | 200  |
| refractive index | n |
| SMILES string | OP(O)(O)=O.OP(O)(O)=O.CCN |
| Biochem/physiol Actions: | Triethylammonium phosphate (TEAP) buffers are highly efficient solvents, that can be used for reversed-phase high-performance liquid chromatography (RP-HPLC). |
| Other Notes: | Mobile phase (15 mM) for reversed phase HPLC of amino acids, peptides and proteins |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.05 g/mL at 20 °C |
| Refractive Index | n |
| UNSPSC | 12161700 |