L-Tyrosine
SIGMA/93829 - BioUltra, ≥99.0% (NT)
Synonym: (S)
CAS Number: 60-18-4
Empirical Formula (Hill Notation): C9H11NO3
Molecular Weight: 181.19
EC Number: 200-460-4
MDL Number: MFCD00002606
Linear Formula: 4-(HO)C6H4CH2CH(NH2)CO2H
Product Type: Chemical
| absorption | cut-off at 310 nm in 1 M HCl at 0.5 M |
| anion traces | chloride (Cl-): ≤400 mg/kg |
| sulfate (SO42-): ≤300 mg/kg | |
| assay | ≥99.0% (NT) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤200 mg/kg | |
| NH4+: ≤200 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | white |
| form | powder or crystals |
| ign. residue | ≤0.1% |
| impurities | insoluble matter, passes filter test |
| ≤0.5% foreign amino acids | |
| InChI | 1S/C9H11NO3/c10-8(9(12)13 |
| InChI key | OUYCCCASQSFEME-QMMMGPOBSA |
| loss | ≤0.2% loss on drying, 20 °C (HV) |
| mp | >300 °C (dec.) (lit.) |
| optical activity | [α]20/D −11.5±1.0°, c = 4% in 1 M HCl |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | N[C@@H](Cc1ccc(O)cc1)C(O) |
| solubility | 1 M HCl: 25 mg/mL, clear, colorless (hot) |
| technique(s) | ligand binding assay: suitable |
| Application: | L-Tyrosine was used in tyrosine hydroxylase (TH) enzyme activity assay. It was also used as a substrate for tyrosinase enzyme in the growth media of Vibrio cholerae strains to stimulate melanin formation. It may be used as a precursor in the synthesis of (-)-MY 336a. MY 336a, a β-adrenergic receptor antagonist, was initially isolated from the culture broth of Streptomyces gabonae KY2234 (ATCC 15282). It may be used in the synthesis of 3-bromo-L-tyrosine and 3,5-dibromo-L-tyrosine. |
| Other Notes: | Amino acid precursor of dopamine and other catecholamines |
| Other Notes: | Growth requirements of various microorganisms |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Purity | ≥99.0% (NT) |
| mp | >300 °C (dec.) (lit.) |
| UNSPSC | 12352209 |