5-Azacytidine
SIGMA/A1287 - Hybri-Max™, γ-irradiated, lyophilized powder, BioXtra, suitable for hybridoma
Synonym: 4-Amino-1-(β-D-ribofuranosyl)-1,3,5-triazin-2(1H)-one; Ladakamycin
CAS Number: 320-67-2
Empirical Formula (Hill Notation): C8H12N4O5
Molecular Weight: 244.20
EC Number: 206-280-2
MDL Number: MFCD00006539
Linear Formula: C8H12N4O5
Product Type: Chemical
| antibiotic activity spectrum | viruses |
| biological source | synthetic (organic) |
| form | lyophilized powder |
| grade | Hybri-Max™ |
| impurities | endotoxin, tested |
| InChI | 1S/C8H12N4O5/c9-7-10-2-12 |
| InChI key | NMUSYJAQQFHJEW-KVTDHHQDSA |
| mode of action | DNA synthesis | interferes |
| mp | 226-232 °C (dec.) (lit.) |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | NC1=NC(=O)N(C=N1)[C@@H]2O |
| solubility | acetic acid: water (1:1): 5 mg/mL, clear, colorless |
| sterility | γ-irradiated |
| storage temp. | −20°C |
| technique(s) | cell culture | hybridoma: suitable |
| Application: | 5-Azacytidine may be used to induce in vitro cardiomyogenic differentiation of adult human bone marrow mesenchymal stem cells. It may also be used to study the effects of 5-Azacytidine on the immune regulatory myeloid-derived suppressor cells (MDSCs) and regulatory T cells (Tregs). |
| Application: | Used to study the effects of the DNA incorporated molecule on DNA methylation processes. |
| Biochem/physiol Actions: | 5-Azacytidine is a deoxycytidine analog and a demethylating agent. It acts as a potential antineoplastic agent for acute myelogenous leukemia. 5-Azacytidine activates repressed genes by inhibiting DNA methylation. 5-Azacytidine also affects protein synthesis by altering the RNA function and stability. |
| Biochem/physiol Actions: | A potent growth inhibitor and cytotoxic agent; inhibits DNA methyltransferase, an important regulatory mechanism of gene expression, gene activation and silencing. |
| General description: | Chemical structure: nucleoside |
| Legal Information: | Hybri-Max is a trademark of Sigma-Aldrich Co. LLC |
| Reconstitution: | Reconstitute contents of vial with 10 mL sterile cell culture medium. Stock solution is sufficient to prepare 500ml medium. Final working concentration: 10 μM 5-azacytidine. |
| Symbol |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302 - H360D |
| Precautionary statements | P201 - P301 + P312 + P330 - P308 + P313 |
| Hazard Codes | T |
| Risk Statements | 45-46-22 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| mp | 226-232 °C (dec.) (lit.) |
| Storage Temp. | −20°C |
| UNSPSC | 12352207 |