Acetylthiocholine chloride
SIGMA/A5626 - ≥99% (TLC), powder
Synonym: (2-
CAS Number: 6050-81-3
Empirical Formula (Hill Notation): C7H16ClNOS
Molecular Weight: 197.73
EC Number: 227-953-7
MDL Number: MFCD00038727
Linear Formula: CH3COSCH2CH2N(CH3)3Cl
Product Type: Chemical
| assay | ≥99% (TLC) |
| form | powder |
| InChI | 1S/C7H16NOS.ClH/c1-7(9)10 |
| InChI key | GZYVLKKMMDFCKR-UHFFFAOYSA |
| Quality Level | 200  |
| SMILES string | [Cl-].CC(=O)SCC[N+](C)(C) |
| solubility | water: 100 mg/mL, clear to slightly hazy, colorless |
| storage temp. | −20°C |
| Application: | Acetylthiocholine chloride has been used to determine the acetylcholine esterase activity of semen exosomes (SE). It has also been used as a substrate for acetylcholine esterase in microcalorimetric study of its kinetic parameters. |
| Biochem/physiol Actions: | Acetylcholinesterase (AChE) enzyme plays an important physiological role in the neurotransmission process. |
| Biochem/physiol Actions: | Acetylcholinesterase substrate and nicotinic acetylcholine receptor agonist. |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280 - P305 + P351 + P338 + P310 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99% (TLC) |
| Storage Temp. | −20°C |
| UNSPSC | 12352204 |