Azadirachtin
SIGMA/A7430 - ~95%
Synonym: azadirachtin A
CAS Number: 11141-17-6
Empirical Formula (Hill Notation): C35H44O16
Molecular Weight: 720.71
MDL Number: MFCD00083241
Linear Formula: C35H44O16
Product Type: Chemical
| application(s) | agriculture environmental |
| assay | ~95% |
| form | solid |
| InChI | 1S/C35H44O16/c1-8-15(2)24 |
| InChI key | FTNJWQUOZFUQQJ-CFYAVYSVSA |
| Quality Level | 100  |
| SMILES string | [H]C1([H])C2OC3([H])OC=CC |
| storage temp. | −20°C |
| Application: | Azadirachtin has been used as a standard for high performance liquid chromatography (HPLC) and for quantification in suspension cultures of Azadirachta indica (A. Juss). |
| Biochem/physiol Actions: | Triterpenoid found in need tree seeds, azadiractin suppresses feeding by many insect species and disrupts growth of most insect and other arthropod species, while having very low mammalian toxicity. Promising as a natural pesticide. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317 - H410 |
| Precautionary statements | P261 - P272 - P273 - P280 - P302 + P352 - P333 + P313 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ~95% |
| Storage Temp. | −20°C |
| UNSPSC | 12352212 |