Synonym: 2-(7-Cyano-8,16-dihydroxy-9,11,13,15-tetramethyl-18-oxooxacyclooctadeca-4,6-dien-2-yl)-cyclopentanecarboxylic acid; Borrelidine; Cyclopentanecarboxylic acid; NSC 216128; Treponemycin
CAS Number: 7184-60-3
Empirical Formula (Hill Notation): C28H43NO6
Molecular Weight: 489.64
MDL Number: MFCD01740784
Linear Formula: C28H43NO6
Product Type: Chemical
| antibiotic activity spectrum |
viruses |
| assay |
≥98% (HPLC) |
| biological source |
Streptomyces parvulus |
| form |
powder |
| InChI |
1S/C28H43NO6/c1-17-12-18(2)14-20(4)27(32)21(16-29)8-5-6-11-25(22-9-7-10-23(22)28(33)34)35-26(31)15-24(30)19(3)13-17/h5-6,8,17-20,22-25,27,30,32H,7,9-15H2,1-4H3,(H,33,34)/b6-5+,21-8-/t17-,18+,19-,20-,22+,23+,24-,25-,27+/m0/s1 |
| InChI key |
OJCKRNPLOZHAOU-UGKRXNSESA-N |
| mode of action |
enzyme | inhibits |
| Quality Level |
200  |
| shipped in |
wet ice |
| SMILES string |
[H][C@]1(CCC[C@H]1C(O)=O)[C@@H]2CC=CC=C(C#N)[C@H](O)[C@@H](C)C[C@H](C)C[C@H](C)C[C@H](C)[C@@H](O)CC(=O)O2 |
| solubility |
DMSO: 1 mg/mL |
| |
methanol: 1 mg/mL |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Borrelidin is a potent angiogenesis inhibitor that induces apoptosis in capillary tube-forming cells. Also displays antimalarial activity against drug-resistant Plasmodia. Antimicrobial and selective threonyl t-RNA synthetase inhibitor. |
| General description: |
Chemical structure: macrolide |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
