Benzoyl peroxide blend with dicyclohexyl phthalate
SIGMA/B5907 - suitable for use as a catalyst for electron microscopy. Modified to render it safe in transit.
Empirical Formula (Hill Notation): C14H10O4
Molecular Weight: 242.23
MDL Number: MFCD00003071
Linear Formula: C14H10O4
Product Type: Chemical
| application(s) | diagnostic assay manufacturing hematology histology |
| contains | 50% dicyclohexyl phthalate as stabilizer |
| form | powder |
| InChI | 1S/C14H10O4/c15-13(11-7-3 |
| InChI key | OMPJBNCRMGITSC-UHFFFAOYSA |
| mp | 54 °C |
| packaging | vial of 9.9 g |
| Quality Level | 200  |
| reaction suitability | reagent type: oxidant |
| SMILES string | O=C(OOC(=O)c1ccccc1)c2ccc |
| storage temp. | 2-8°C |
| Other Notes: | Formulated specifically for use with Histocryl and LR white acrylic resins. |
| Symbol |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H242 - H317 - H319 - H360D - H410 |
| Precautionary statements | P210 - P235 - P273 - P280 - P308 + P313 - P370 + P378 |
| Hazard Codes | E,Xi |
| Risk Statements | 3-7-36/37/38-43 |
| Safety Statements | 3/7-14-26-35-36/37/39 |
| RIDADR | UN 3106A7 5.2 |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 54 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12171500 |