Cytosporone B
SIGMA/C2997 - ≥98% (HPLC)
Synonym: 3,5-
CAS Number: 321661-62-5
Empirical Formula (Hill Notation): C18H26O5
Molecular Weight: 322.40
MDL Number: MFCD12912406
Linear Formula: C18H26O5
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | white to off-white |
| form | powder |
| InChI | 1S/C18H26O5/c1-3-5-6-7-8- |
| InChI key | UVVWQQKSNZLUQA-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | CCCCCCCC(=O)c1c(O)cc(O)cc |
| solubility | DMSO: >20 mg/mL |
| storage temp. | −20°C |
| Application: | Cytosporone B has been used: • as a positive control and NR4A1 agonist in NR4A1 reporter gene assay • for Nr4a1 activation • to treat OVX mice and study its effect on migration of osteoclast precursor |
| Biochem/physiol Actions: | Cytosporone B (Csn-B) is the first naturally occurring agonist for nuclear orphan receptor Nur77. |
| Biochem/physiol Actions: | Cytosporone B (Csn-B) is the first naturally occurring agonist for nuclear orphan receptor Nur77. It binds with high affinity (IC50=0.278 nM) to the ligand-binding domain of Nur77 and stimulates Nur77-dependent activities. Nur77 is a nuclear receptor/transcription factor. A physiological ligand for Nur77 is as yet unknown, but there is increasing interest in Nur77 because of its known activities. Translocation of Nur77 from the nucleus to mitochondria initiates cell apoptosis, making it a potential target for cancer treatment. Nur77 is also involved in glucose homeostasis; it induces genes involved in gluconeogenesis. Csn-B physically binds to Nur77 and activates its transactivational activity and translocation to mitochondria to induce apoptosis. It inhibits cancer cell proliferation and tumor growth. |
| Biochem/physiol Actions: | Cytosporone B is a fungal metabolite closely related to phomposin C. It is the first known agonist for the nuclear orphan receptor Nur77. It binds with high affinity (IC50 = 0.278 nM) to the ligand-binding domain of Nur77 and stimulates Nur77-dependent activities. Nur77 is a nuclear receptor/transcription factor with no known physiological ligand, but there is increasing interest in Nur77 because of its known activities. Translocation of Nur77 from the nucleus to mitochondria initiates apoptosis, making it a potential target for cancer chemotherapy. Nur77 also induces genes involved in gluconeogenesis. Csn-B activates the Nur77 translocation to mitochondria to induce apoptosis, inhibiting cancer cell proliferation and tumor growth. |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264 - P270 - P301 + P312 - P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | −20°C |
| UNSPSC | 12352200 |


