Synonym: 1-Ethyl-1,4-dihydro-4-oxo-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid
CAS Number: 28657-80-9
Empirical Formula (Hill Notation): C12H10N2O5
Molecular Weight: 262.22
EC Number: 249-133-8
MDL Number: MFCD00056776
Linear Formula: C12H10N2O5
Product Type: Chemical
| antibiotic activity spectrum |
Gram-negative bacteria |
| form |
powder or crystals |
| InChI |
1S/C12H10N2O5/c1-2-14-7-4-9-8(18-5-19-9)3-6(7)11(15)10(13-14)12(16)17/h3-4H,2,5H2,1H3,(H,16,17) |
| InChI key |
VDUWPHTZYNWKRN-UHFFFAOYSA-N |
| mode of action |
DNA synthesis | interferes |
| |
enzyme | inhibits |
| Quality Level |
200  |
| SMILES string |
CCN1N=C(C(O)=O)C(=O)c2cc3OCOc3cc12 |
| Application: |
Cinoxacin was used to study the rat renal organic anion transporter 1 (OAT1). It is used to study fluoroquinolone-resistant Streptococcus pyogenes. |
| Biochem/physiol Actions: |
Cinoxacin is a synthetic antimicrobial agent that interferes with DNA replication by inhibiting DNA gyrase and topoisomerase IV (topo IV) through tight DNA binding. The mechanism of action of cinoxacin is comparable to nalidixic acid. Cinoxacin is effective against Gram-negative bacteria and is often used to treat urinary tract infections caused by E. coli, Proteus mirabilis, Proteus vulgaris and Klebsiella sp. |
| General description: |
Chemical structure: quinolone |
| Other Notes: |
Keep container tightly closed in a dry and well-ventilated place. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
