DIPSO
SIGMA/D0306 - BioXtra, pH 4.0-5.5 (20 °C, 0.1 M in H2O), ≥98% (titration)
Synonym: 3-(N,N-
CAS Number: 68399-80-4
Empirical Formula (Hill Notation): C7H17NO6S
Molecular Weight: 243.28
EC Number: 269-992-2
MDL Number: MFCD00038353
Linear Formula: C7H17NO6S
Product Type: Chemical
FT-NMR Spectra for 3-(N,N-Bis[2-hydroxyethyl]amino)-2-hydroxypropanesulfonic acid.
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: D0306-25G
This image depicts SKU: D0306-25G
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: D0306-100G
This image depicts SKU: D0306-100G
| absorption | ≤0.025 at 260 in H2O at 0.1 M |
| ≤0.025 at 280 in H2O at 0.1 M | |
| anion traces | chloride (Cl-): ≤0.05% |
| sulfate (SO42-): ≤0.05% | |
| application(s) | diagnostic assay manufacturing |
| assay | ≥98% (titration) |
| cation traces | Al: ≤0.0005% |
| Ca: ≤0.001% | |
| Cu: ≤0.0005% | |
| Fe: ≤0.0005% | |
| K: ≤0.005% | |
| Mg: ≤0.0005% | |
| Na: ≤0.01% | |
| NH4+: ≤0.05% | |
| Pb: ≤0.001% | |
| Zn: ≤0.0005% | |
| form | powder |
| ign. residue | ≤0.1% |
| impurities | ≤0.0005% Phosphorus (P) |
| ≤0.1% Insoluble matter | |
| InChI | 1S/C7H17NO6S/c9-3-1-8(2-4 |
| InChI key | XCBLFURAFHFFJF-UHFFFAOYSA |
| mp | 189-192 °C (lit.) |
| pH | 4.0-5.5 (20 °C, 0.1 M in H2O) |
| pKa (25 °C) | 7.6 |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | OCCN(CCO)CC(O)CS(O)(=O)=O |
| solubility | H2O: 0.1 M, clear, colorless |
| useful pH range | 7.0-8.2 |
| Packaging: | 25, 100 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (titration) |
| mp | 189-192 °C (lit.) |
| UNSPSC | 12161700 |