Synonym: 3β-Acetoxy-5,16-pregnadien-20-one; 3β-Hydroxy-5,16-pregnadien-20-one acetate; 5,16-Pregnadien-3β-ol-20-one acetate
CAS Number: 979-02-2
Empirical Formula (Hill Notation): C23H32O3
Molecular Weight: 356.50
EC Number: 213-558-7
MDL Number: MFCD00051130
Linear Formula: C23H32O3
Product Type: Chemical
| assay |
≥95% |
| form |
powder |
| InChI |
1S/C23H32O3/c1-14(24)19-7-8-20-18-6-5-16-13-17(26-15(2)25)9-11-22(16,3)21(18)10-12-23(19,20)4/h5,7,17-18,20-21H,6,8-13H2,1-4H3 |
| InChI key |
MZWRIOUCMXPLKV-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CC(=O)OC1CCC2(C)C3CCC4(C)C(CC=C4C(C)=O)C3CC=C2C1 |
| Biochem/physiol Actions: |
16-Dehydropregnenolone acetate (DPA) is synthesized from steroids sapogenin, diosgenin and solasodine. 16-Dehydropregnenolone acetate (DPA) is a crucial intermediate for the synthesis of steroid hormones-based drugs. It is an antagonist for farnesoid X receptor (FXR) and modulates cholesterol metabolism. It is considered as a potential antihyperlipidemic agent. Chemically synthesized steroid derivatives from DPA have cytotoxic features and could serve as potential anticancer agents. |
| Packaging: |
10 g in poly bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% |
| UNSPSC |
12352202 |
