Dihydrostreptomycin sesquisulfate
SIGMA/D7253
Synonym: Didromycin; Dihydrostreptomycin 3/2 sulfate; Dihydrostreptomycin sulfate
CAS Number: 5490-27-7
Empirical Formula (Hill Notation): C21H41N7O12·1.5H2SO4
Molecular Weight: 730.71
EC Number: 226-823-7
MDL Number: MFCD00070252
Linear Formula: C21H41N7O12 · 3/2H2SO4
Product Type: Chemical
| antibiotic activity spectrum | Gram-negative bacteria |
| Gram-positive bacteria | |
| mycobacteria | |
| biological source | microbial |
| color | white to off-white |
| form | powder |
| InChI | 1S/2C21H41N7O12.3H2O4S/c2 |
| InChI key | CZWJCQXZZJHHRH-YZTFXSNBSA |
| mode of action | protein synthesis | interferes |
| Quality Level | 200 ![]() |
| SMILES string | OS(O)(=O)=O.OS(O)(=O)=O.O |
| storage temp. | 2-8°C |
| Application: | Dihydrostreptomycin sesquisulfate is a derivative of streptomycin used in aminoglycoside uptake studies. It has also been used as an electrode for a cochlear amplifier in the hair-cell bundle of lizards. |
| Biochem/physiol Actions: | Mode of Action: Dihydrostreptomycin sesquisulfate inhibits protein synthesis at the level of the 30s ribosomal subunit and the 16s rRNA. |
| General description: | Chemical structure: aminoglycoside |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302 - H361fd |
| Precautionary statements | P201 - P301 + P312 + P330 - P308 + P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | 2-8°C |
| UNSPSC | 51102829 |



