Synonym: 1,3,5-Estratriene-3,17β-diol; 17β-Estradiol; 3,17β-Dihydroxy-1,3,5(10)-estratriene; Dihydrofolliculin
CAS Number: 50-28-2
Empirical Formula (Hill Notation): C18H24O2
Molecular Weight: 272.38
EC Number: 200-023-8
MDL Number: MFCD00003693
Linear Formula: C18H24O2
Product Type: Chemical
| application(s) |
pharmaceutical |
| grade |
analytical standard |
| InChI |
1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChI key |
VOXZDWNPVJITMN-ZBRFXRBCSA-N |
| mp |
176-180 °C (lit.) |
| packaging |
vial of 250 mg |
| Quality Level |
200  |
| SMILES string |
O[C@H]1CC[C@@]2([H])[C@]3([H])CCC4=CC(O)=CC=C4[C@@]3([H])CC[C@@]21C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Biochem/physiol Actions: |
The major estrogen secreted by the premenopausal ovary. |
| Biochem/physiol Actions: |
The major estrogen secreted by the premenopausal ovary. Estrogens direct the development of the female phenotype in embryogenesis and during puberty by regulating gene transcription and, thus, protein synthesis. It also induces the production of gonadotropins which, in turn, induce ovulation. Exposure to estradiol increases breast cancer incidence and proliferation. |
| Packaging: |
1 vial in poly bottle |
| Packaging: |
Supplied in amber screw-cap vials |
| mp |
176-180 °C (lit.) |
| UNSPSC |
12352104 |
GHS08,GHS09