Synonym: Biphenyl-2-yl-(7-nitrobenzo[1,2,5]oxadiazol-4-yl)amine; N-2-Biphenylyl-7-nitro-2,1,3-benzoxadiazol-4-amine; N-[1,1′-Biphenyl-2-yl]-7-nitro-2,1,3-Benzoxadiazol-4-amine
CAS Number: 413611-93-5
Empirical Formula (Hill Notation): C18H12N4O3
Molecular Weight: 332.31
MDL Number: MFCD00576774
Linear Formula: C18H12N4O3
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
red |
| form |
powder |
| InChI |
1S/C18H12N4O3/c23-22(24)16-11-10-15(17-18(16)21-25-20-17)19-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-11,19H |
| InChI key |
KMJPYSQOCBYMCF-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
[O-][N+](=O)c1ccc(Nc2ccccc2-c3ccccc3)c4nonc14 |
| solubility |
DMSO: >10 mg/mL |
| storage temp. |
room temp |
| Biochem/physiol Actions: |
10074-G5 is a c-Myc/Max interaction inhibitor. |
| Biochem/physiol Actions: |
10074-G5 is a c-Myc/Max interaction inhibitor. The c-Myc oncoprotein and its partner Max are intrinsically disordered (ID) monomers that undergo coupled folding and binding upon heterodimerization. 10074-G5, similarly to 10058-F4 (#F3680), specifically inhibits this interaction by binding to c-Myc, thus preventing C-Myc specific DNA binding and target genes regulation. 10074-G5 (2.8 microM) is slightly more potent that 10058-F4 (5.2 microM). It was discovered that 10074-G5 binds to a different specific binding site (region) of C-Myc than 10054-F4. Thus, the compound may become desirable for probing different interactions. |
| Packaging: |
5, 25 mg in glass bottle |
| Hazard Codes |
T |
| Risk Statements |
25-36/37/38 |
| Safety Statements |
26-45 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
room temp |
| UNSPSC |
12352200 |
