Genapol® X-100
SIGMA/G6923
Synonym: Isotridecanol ethoxylate; Isotridecyl alcohol polyglycol ether (10 EO); PEG isotridecyl ether; Polyethylene glycol monoisotridecyl ether; Polyoxyethylene (10) Isotridecyl Ether
CAS Number: 9043-30-5
MDL Number: MFCD00043375; MFCD00163738
Product Type: Chemical
| aggregation number | 88 |
| CMC | 0.15 mM (20-25°C) |
| 19.5 | |
| description | non-ionic |
| HLB | 13 - 14 |
| InChI | 1S/C30H62O10/c1-2-3-4-5-6 |
| InChI key | ONJQDTZCDSESIW-UHFFFAOYSA |
| mol wt | micellar average mol wt 56000 |
| Quality Level | 200 ![]() |
| SMILES string | O(CCOCCOCCOCCOCCO)CCOCCOC |
| transition temp | cloud point 82 °C |
| Application: | Genapol X-100 has been used in a study to assess how detergents affect inhibitor potencies against cyclo-oxygenase isoforms. It has also been used in a study to investigate the solubilisation of the membrane-bound D-alanyl-D-alanine carboxypeptidase of Bacillus coagulans. |
| Legal Information: | Genapol is a registered trademark of Clariant GmbH |
| Packaging: | 1 L in poly bottle |
| Symbol | ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302 - H318 |
| Precautionary statements | P280 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 374.0 °F - closed cup |
| Flash Point(C) | 190 °C - closed cup |
| UNSPSC | 12161900 |



