Gibberellin A4
SIGMA/G7276 - suitable for plant cell culture, BioReagent, ≥90%
CAS Number: 468-44-0
Empirical Formula (Hill Notation): C19H24O5
Molecular Weight: 332.39
EC Number: 207-406-9
MDL Number: MFCD00133363
Linear Formula: C19H24O5
Product Type: Chemical
| application(s) | agriculture |
| assay | ≥90% |
| form | solid |
| impurities | ≤5% gibberellin A7 |
| InChI | 1S/C19H24O5/c1-9-7-18-8-1 |
| InChI key | RSQSQJNRHICNNH-AMNRFOROSA |
| product line | BioReagent |
| Quality Level | 200  |
| SMILES string | [H][C@@]12CC[C@@H]3C[C@]1 |
| storage temp. | −20°C |
| technique(s) | cell culture | plant: suitable |
| Application: | Gibberellin A4 has been used as a supplement in Murashige and Skoog (MS) media for enhancing plant growth. |
| Biochem/physiol Actions: | Gibberillic acids (GA) are important plant growth hormones that promote plant cell growth and elongation. Gebberillins promote rapid stem and root growth, induce mitotic division and initiate (break dormancy) and increase seed germination rates. The gibberellins are also involved in processes such as gravitropism, tensioning and floral display. |
| Packaging: | 5 mg in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥90% |
| Storage Temp. | −20°C |
| UNSPSC | 10171502 |