Synonym: 2,3,4,5-Tetra(4-pyridyl)thiophene; 4,4′,4′′,4′′′-Thiene-2,3,4,5-tetrayltetrapyridine
CAS Number: 64048-12-0
Empirical Formula (Hill Notation): C24H16N4S
Molecular Weight: 392.48
MDL Number: MFCD01103196
Linear Formula: C24H16N4S
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to pale yellow |
| InChI |
1S/C24H16N4S/c1-9-25-10-2-17(1)21-22(18-3-11-26-12-4-18)24(20-7-15-28-16-8-20)29-23(21)19-5-13-27-14-6-19/h1-16H |
| InChI key |
USWLOKMMUTWFMD-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
c1cc(ccn1)-c2sc(-c3ccncc3)c(-c4ccncc4)c2-c5ccncc5 |
| solubility |
DMSO: >10 mg/mL |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
GANT58 is a Hedgehog signaling pathway inhibitor. |
| Biochem/physiol Actions: |
GANT58 is a Hedgehog signaling pathway inhibitor. GANT58 inhibits the hedgehog signaling pathway downstream of Smo. GANT58 inhibits Gli transcriptional activity, and reduces cellular levels of the Hh pathway components Gli1, Shh, and patched. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
51111800 |
