Synonym: 2,2′-[[Dihydro-2-(4-pyridinyl)-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-dimethyl-benzenamine; NSC 136476
CAS Number: 500579-04-4
Empirical Formula (Hill Notation): C27H35N5
Molecular Weight: 429.60
MDL Number: MFCD14635408
Linear Formula: C27H35N5
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to off-white |
| form |
powder |
| InChI |
1S/C27H35N5/c1-29(2)25-12-7-5-10-23(25)20-31-18-9-19-32(27(31)22-14-16-28-17-15-22)21-24-11-6-8-13-26(24)30(3)4/h5-8,10-17,27H,9,18-21H2,1-4H3 |
| InChI key |
KVQOGDQTWWCZFX-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
N2(C(N(CCC2)Cc4c(cccc4)N(C)C)c3ccncc3)Cc1c(cccc1)N(C)C |
| solubility |
DMSO: >2 mg/mL |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
GANT61 blocks hedgehog pathway signaling by inhibiting the transcripional activity of Gli1 (IC50 = 5 μM). GANT 61 led to a regression of 22Rv1 human prostate tumor cell xenografts in nude mice. |
| Biochem/physiol Actions: |
GANT61 is a Hh pathway Gli Inhibitor. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
51111800 |
