Hematoxylin Solution, Gill No. 1
SIGMA/GHS116
MDL Number: MFCD00078111
Product Type: Chemical
| application(s) | hematology histology |
| concentration | 2 g/L |
| form | solution |
| InChI | 1S/C16H14O6/c17-10-2-1-8- |
| InChI key | WZUVPPKBWHMQCE-XJKSGUPXSA |
| IVD | for in vitro diagnostic use |
| pH | 2.5-3.5 |
| Quality Level | 500 ![]() |
| shelf life | Expiry date on the label. |
| SMILES string | Oc1cc2C[C@@]3(O)COc4c(O)c |
| storage temp. | room temp |
| Application: | Gill No. 1 formulation is used as a progressive cytology stain. Used with hematoxylin and eosin staining. |
| Other Notes: | 2 g/L certified hematoxylin |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302 - H373 |
| Precautionary statements | P260 - P264 - P270 - P301 + P312 - P314 - P501 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | room temp |
| UNSPSC | 41116124 |



