Giemsa Stain, Modified
SIGMA/GS80
Synonym: Giemsa Solution
MDL Number: MFCD00081642
Product Type: Chemical
| application(s) | hematology histology |
| concentration | 0.4 % (w/v) in buffered methanol solution, pH 6.8, with stabilizers |
| form | solution |
| InChI | 1S/C14H13N3S.ClH/c1-17(2) |
| InChI key | NALREUIWICQLPS-UHFFFAOYSA |
| IVD | for in vitro diagnostic use |
| pH | 6.75-6.95 |
| Quality Level | 500 ![]() |
| shelf life | Expiry date on the label. |
| SMILES string | [Cl-].CN(C)c1ccc2N=C3C=CC |
| storage temp. | room temp |
| Application: | When blood films are stained using Giemsa Stain, the nucleus and cytoplasm of white blood cells take on characteristic blue or pink coloration. The use of purified eosin and thiazine dyes minimizes lot-to-lot variation. |
| Symbol | ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225 - H301 + H311 + H331 - H370 |
| Precautionary statements | P210 - P280 - P301 + P310 + P330 - P302 + P352 + P312 - P304 + P340 + P311 |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | WGK 3 |
| Flash Point(F) | 51.8 °F - closed cup |
| Flash Point(C) | 11 °C - closed cup |
| Storage Temp. | room temp |
| UNSPSC | 41116121 |




