6-Hydroxy-DL-DOPA
SIGMA/H2380 - ≥98% (HPLC), powder
Synonym: 2,4,5-Trihydroxy-DL-phenylalanine; 2,5-Dihydroxy-DL-tyrosine
CAS Number: 21373-30-8
Empirical Formula (Hill Notation): C9H11NO5
Molecular Weight: 213.19
MDL Number: MFCD00004272
Linear Formula: C9H11NO5
Product Type: Chemical
FT-NMR Spectra for 2,4,5-Trihydroxy-ᴅʟ-phenylalanine.
| assay | ≥98% (HPLC) |
| color | off-white |
| form | powder |
| InChI | 1S/C9H11NO5/c10-5(9(14)15 |
| InChI key | YLKRUSPZOTYMAT-UHFFFAOYSA |
| Quality Level | 200  |
| SMILES string | NC(Cc1cc(O)c(O)cc1O)C(O)= |
| solubility | 1 M HCl: 50 mg/mL (Solutions should be freshly prepared and protected from exposure to light.) |
| H2O: 3 mg/mL | |
| storage temp. | −20°C |
| Biochem/physiol Actions: | 6-Hydroxy-DL-DOPA is an inhibitor of APE1 (apurinic/apyrimidinic endonuclease) repair-function activity. APE1 is a nuclease crucial for DNA base excision repair pathway. 6-Hydroxy-DL-DOPA also blocks RAD52 (DNA repair protein) single-stranded DNA binding domain. |
| Biochem/physiol Actions: | Precursor 6-hydroxydopamine. |
| Biochem/physiol Actions: | Precursor of the catecholaminergic neurotoxin, 6-hydroxydopamine; converted to 6-hydroxydopamine by |
| Disclaimer: | Hygroscopic; photosensitive |
| General description: | Dissolve in oxygen-free boiled water containing 0.1% sodium metabisulfite or other antioxidant. Solutions should be freshly prepared and protected from exposure to light. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | −20°C |
| UNSPSC | 12352200 |