Phosphomolybdic Acid Solution
SIGMA/HT153
Synonym: Phosphomolybdic acid solution; Molybdophosphoric acid
CAS Number: 12026-57-2
Empirical Formula (Hill Notation): H3Mo12O40P
Molecular Weight: 1825.25
MDL Number: MFCD00011341
Linear Formula: H3[P(Mo3O10)4]
Product Type: Chemical
| application(s) | hematology histology |
| concentration | 10% |
| form | solution |
| InChI | 1S/12Mo.H3O4P.36O/c;;;;;; |
| InChI key | DHRLEVQXOMLTIM-UHFFFAOYSA |
| IVD | for in vitro diagnostic use |
| Quality Level | 500 ![]() |
| reaction suitability | reagent type: oxidant |
| shelf life | Expiry date on the label |
| SMILES string | O=[Mo](=O)=O.O=[Mo](=O)=O |
| storage temp. | room temp |
| Application: | Intended for use in the Sigma Masson Trichrome Procedure, HT15. |
| Preparation Note: | Phosphomolydic Acid, 10%. Formation of precipitate does not affect performance in the Masson Trichrome Procedure. |
| Symbol | ![]() GHS03,GHS05 |
| Signal word | Danger |
| Hazard statements | H272 - H314 |
| Precautionary statements | P210 - P220 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | O,C |
| Risk Statements | 8-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3264 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | room temp |
| UNSPSC | 12352106 |



