5-Iodo-2′-deoxyuridine
SIGMA/I7125 - ≥99% (HPLC)
Synonym: 1-(2-Deoxy-β-D-ribofuranosyl)-5-iodouracil; 2′-Deoxy-5-iodouridine; 5-IUdR; IDU; IdUrd; Idoxuridine
CAS Number: 54-42-2
Empirical Formula (Hill Notation): C9H11IN2O5
Molecular Weight: 354.10
EC Number: 200-207-8
MDL Number: MFCD00134656
Linear Formula: C9H11IN2O5
Product Type: Chemical
| assay | ≥99% (HPLC) |
| biological source | synthetic (organic) |
| form | powder or crystals |
| InChI | 1S/C9H11IN2O5/c10-4-2-12( |
| InChI key | XQFRJNBWHJMXHO-RRKCRQDMSA |
| mp | 194 °C (lit.) |
| Quality Level | 200  |
| SMILES string | OC[C@H]1O[C@H](C[C@@H]1O) |
| solubility | 1 N NH4OH: 50 mg/mL, clear to very slightly hazy, colorless to light yellow |
| storage temp. | 2-8°C |
| Application: | 5-Iodo-2′-deoxyuridine (5-IUdR; IdUrd) is a pyrimidine analog (halogenated thymidine) that has antiviral activity agains vaccinia virus (orthopoxviruses). IdUrd is used as a radiosensitizer in human cancer studies. |
| Application: | 5-Iodo-2′-deoxyuridine has been used in molecular combing assay or DNA fiber assay. |
| Biochem/physiol Actions: | 5-Iodo-2′-deoxyuridine prevents in vitro DNA viral replication. This is observed in herpesviruses and poxviruses It might possess teratogenic, tumor-promoting, mutagenic, and immunosuppressive properties. 5-Iodo-2′-deoxyuridine, used in topical applications, is effective against epithelial infections. |
| Packaging: | 5, 25 g in glass bottle |
| Symbol |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 - H341 - H361 |
| Precautionary statements | P201 - P302 + P352 - P305 + P351 + P338 - P308 + P313 |
| Hazard Codes | Xn |
| Risk Statements | 63-36/37/38-62-68 |
| Safety Statements | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99% (HPLC) |
| mp | 194 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 41106305 |