Synonym: K858; N-(4-Acetyl-4,5-dihydro-5-methyl-5-phenyl-1,3,4-thiadia zol-2-yl)acetamide
CAS Number: 72926-24-0
Empirical Formula (Hill Notation): C13H15N3O2S
Molecular Weight: 277.34
MDL Number: MFCD00181155
Linear Formula: C13H15N3O2S
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to off-white |
| form |
powder |
| InChI |
1S/C13H15N3O2S/c1-9(17)14-12-15-16(10(2)18)13(3,19-12)11-7-5-4-6-8-11/h4-8H,1-3H3,(H,14,15,17) |
| InChI key |
JEFVYQYZCAVNTP-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CC(=O)NC1=NN(C(C)=O)C(C)(S1)c2ccccc2 |
| solubility |
DMSO: ≥20 mg/mL |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
A thiadiazoline derivative reported as a selective ATP-uncompetitive mitotic kinesin Eg5 inhibitor. |
| Biochem/physiol Actions: |
Eg5 is a key protein involved in the formation of bipolar spindles. K858 is a selective ATP-uncompetitive mitotic kinesin Eg5 inhibitor. The compound induces mitotic arrest, caspase-3 activation and cell growth inhibition in HCT116 cells. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 1 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352202 |
