Synonym: 1,6-Dimethyl-pyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione; Toxoflavin; Xanthothricin
CAS Number: 84-82-2
Empirical Formula (Hill Notation): C7H7N5O2
Molecular Weight: 193.16
MDL Number: MFCD00459812
Linear Formula: C7H7N5O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to light brown |
| form |
powder |
| InChI |
1S/C7H7N5O2/c1-11-6(13)4-5(10-7(11)14)12(2)9-3-8-4/h3H,1-2H3 |
| InChI key |
SLGRAIAQIAUZAQ-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CN1N=CN=C(C1=N2)C(N(C)C2=O)=O |
| solubility |
H2O: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
PKF118-310 is a Tcf4/b-catenin antagonist. |
| Biochem/physiol Actions: |
PKF118-310 is an antagonist of the Tcf4/b-catenin signaling. The compound disrupts the Tcf4/b-catenin complex and inhibits expression of Tcf4 responsive genes. PKF118-310 inhibits expression of survivin and induces apoptosis in HCC, colon tumor and lymphocytic leukemia cell lines. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H300 |
| Precautionary statements |
P264 - P270 - P301 + P310 - P405 - P501 |
| Hazard Codes |
T |
| Risk Statements |
28 |
| Safety Statements |
45-46 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
