Synonym: (5S,6R,15S)-Trihydroxy-(7E,9E,11Z,13E)-Eicosatetraenoic acid
CAS Number: 89663-86-5
Empirical Formula (Hill Notation): C20H32O5
Molecular Weight: 352.47
EC Number: 200-578-6
MDL Number: MFCD00065845
Linear Formula: C20H32O5
Product Type: Chemical
| form |
ethanol solution |
| InChI |
1S/C20H32O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h4-7,9-10,13-14,17-19,21-23H,2-3,8,11-12,15-16H2,1H3,(H,24,25)/b6-4-,7-5+,13-9+,14-10+/t17-,18+,19-/m0/s1 |
| InChI key |
IXAQOQZEOGMIQS-SSQFXEBMSA-N |
| Quality Level |
200  |
| shipped in |
dry ice |
| SMILES string |
CCCCC[C@H](O)C=CC=C/C=C/C=C/[C@@H](O)[C@@H](O)CCCC(O)=O |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Lipoxin A4 (LXA4) is synthesized from arachidonic acid and is an endogenous lipoxygenase-derived eicosanoid mediator. It is a potent human protein kinase C activator. It inhibits cytotoxicity of natural killer cells. LXA4 regulates the immune system and inflammation. In the brain, it modulates neuronal signaling and slow wave sleep. LXA4 binds to cannabinoid receptors. LXA4 plays a key role in the maintenance of endometrium and reproductive function. Depletion of LXA4 contributes to the pathophysiology of cystic fibrosis (CF). |
| Packaging: |
Packaged under argon. |
| Storage Temp. |
−20°C |
| UNSPSC |
12352211 |
GHS02,GHS07