N-Lauroylsarcosine sodium salt
SIGMA/L5125 - ≥94%
Synonym: N-Dodecanoyl-N-methylglycine sodium salt; Sarkosyl NL
CAS Number: 137-16-6
Empirical Formula (Hill Notation): C15H28NNaO3
Molecular Weight: 293.38
EC Number: 205-281-5
MDL Number: MFCD00042728
Linear Formula: CH3(CH2)10CON(CH3)CH2COONa
Product Type: Chemical
| aggregation number | 2 |
| assay | ≥94% |
| CMC | 14.6 mM (20-25°C) |
| density | 1,14 g/cm3 at 20 °C (1,14 g/cm3 at 20 °C) |
| description | anionic |
| form | powder |
| InChI | 1S/C15H29NO3.Na/c1-3-4-5- |
| InChI key | KSAVQLQVUXSOCR-UHFFFAOYSA |
| mol wt | average mol wt 600 |
| micellar avg mol wt 600 | |
| Quality Level | 200 ![]() |
| SMILES string | [Na+].CCCCCCCCCCCC(=O)N(C |
| solubility | H2O: 100 mg/mL, clear to slightly hazy, colorless to faintly yellow |
| technique(s) | oligo synthesis: suitable |
| Application: | N-Lauroylsarcosine sodium salt has been used as one of the components of the lysing solution in the cornet assay. It has been used for lysing protoplasts in the process of chromosomal DNA isolation form Streptococcus mutans. |
| Biochem/physiol Actions: | N-Lauroylsarcosine is an anionic surfactant which also has protein denaturant potency. In addition, it has been shown as a microbicide for sexually transmitted diseases. |
| Other Notes: | Anionic surfactant. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 50, 100, 500 g in poly bottle |
| Symbol | ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H315 - H318 - H330 |
| Precautionary statements | P280 - P302 + P352 - P304 + P340 + P310 - P305 + P351 + P338 + P310 |
| Hazard Codes | T |
| Risk Statements | 23-38-41 |
| Safety Statements | 22-26-37/39-38-45 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | WGK 1 |
| Purity | ≥94% |
| Density | 1,14 g/cm3 at 20 °C (1,14 g/cm3 at 20 °C) |
| UNSPSC | 12352107 |



