Synonym: LAT-A; [1R-[1R*, 4Z, 8E, 10Z, 12S*, 15R*, 17R*(R*)]]-4-(17-Hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl)-2-thiazolidinone
CAS Number: 76343-93-6
Empirical Formula (Hill Notation): C22H31NO5S
Molecular Weight: 421.55
Linear Formula: C22H31NO5S
Product Type: Chemical
| assay |
≥85% (HPLC) |
| biological source |
sea sponge |
| form |
waxy solid |
| InChI |
1S/C22H31NO5S/c1-15-7-5-3-4-6-8-16(2)11-20(24)27-18-12-17(10-9-15)28-22(26,13-18)19-14-29-21(25)23-19/h3-5,7,11,15,17-19,26H,6,8-10,12-14H2,1-2H3,(H,23,25)/b4-3+,7-5-,16-11-/t15-,17-,18-,19+,22-/m1/s1 |
| InChI key |
DDVBPZROPPMBLW-IZGXTMSKSA-N |
| mol wt |
421.6 |
| Quality Level |
200  |
| SMILES string |
C[C@H]1CC[C@@H]2C[C@H](C[C@@](O)(O2)[C@@H]3CSC(=O)N3)OC(=O)C=C(C)CCC=CC=C1 |
| solubility |
DMSO: soluble |
| |
ethanol: soluble |
| storage temp. |
−20°C |
| Application: |
Latrunculin A has been used as medium supplementation for A549 cells to determine the internalization mechanism of CAV9 in A549 human lung carcinoma cells. |
| Biochem/physiol Actions: |
Latrunculin A inhibits actin polymerization by a different mechanism than cytochalasins. Latrunculin A disrupts microfilament-mediated processes. |
| General description: |
Latrunculin A, a toxin extracted from the red sea sponge Latrunculia magnifica. It participates in vitro in the morphological alteration of the polymerization of pure actin. It forms a complex by binding with the nucleotide cleft of actin for actin filaments elongation. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥85% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
