Synonym: 11α,15S-Dihydroxy-17S,20-dimethyl-9-oxo-prosta-2E,13E-dien-1-oic acid; 17α,20-dimethyl-δ2-PGE1
CAS Number: 74397-12-9
Empirical Formula (Hill Notation): C22H36O5
Molecular Weight: 380.52
MDL Number: MFCD00868275
Linear Formula: C22H36O5
Product Type: Chemical
| assay |
≥99% |
| form |
crystalline |
| InChI |
1S/C22H36O5/c1-3-4-9-16(2)14-17(23)12-13-19-18(20(24)15-21(19)25)10-7-5-6-8-11-22(26)27/h8,11-13,16-19,21,23,25H,3-7,9-10,14-15H2,1-2H3,(H,26,27)/b11-8+,13-12+/t16-,17+,18+,19+,21+/m0/s1 |
| InChI key |
OJZYRQPMEIEQFC-UAWLTFRCSA-N |
| Quality Level |
200  |
| shipped in |
wet ice |
| SMILES string |
CCCC[C@H](C)C[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCC=CC(O)=O |
| solubility |
DMF: soluble |
| |
DMSO: soluble |
| |
ethanol: soluble |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Limaprost exhibits cytoprotective, vasodilatory, and antiplatelet activity. Limaprost has the potential to treat lumbar spinal canal stenosis (LSCS) and several ischaemic symptoms of thromboangiitis obliterans (TAO). |
| Other Notes: |
Potent analog of PGE1 with prolonged half-life. |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H300 |
| Precautionary statements |
P264 - P301 + P310 |
| Hazard Codes |
T |
| Risk Statements |
25 |
| Safety Statements |
36/37/39-45 |
| RIDADR |
UN 2811 6.1 / PGII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99% |
| Storage Temp. |
−20°C |
| UNSPSC |
51111800 |
