N-Lauroylsarcosine sodium salt solution
SIGMA/L7414 - Molecular Biology, 20%
Synonym: Sarcosyl; Sarkosyl NL; Sodium N-
CAS Number: 137-16-6
Empirical Formula (Hill Notation): C15H28NNaO3
Molecular Weight: 293.38
MDL Number: MFCD00042728
Linear Formula: CH3(CH2)10CON(CH3)CH2COONa
Product Type: Chemical
| assay | 19-21% |
| biological source | plant |
| concentration | 19-21% (Titration by HClO4) |
| 20% | |
| description | anionic |
| foreign activity | DNase, RNase, and protease, none detected |
| form | liquid |
| grade | Molecular Biology |
| InChI | 1S/C15H29NO3.Na/c1-3-4-5- |
| InChI key | KSAVQLQVUXSOCR-UHFFFAOYSA |
| mol wt | 293.38 g/mol |
| Quality Level | 200 ![]() |
| SMILES string | [Na+].CCCCCCCCCCCC(=O)N(C |
| solubility | water: soluble at 20 °C |
| Application: | N-Lauroylsarcosine sodium salt has been used in a study to assess the mechanisms underlying surfactant-induced itching. It has also been used in a study to investigate the formation of pH-responsive, stable vesicles resulting from an interaction with N-cetylpyridinium chloride (CPC) and N-dodecylpyridinium chloride (DPC) in aqueous mixtures. |
| Features and Benefits: | N-Lauroylsarcosine does not precipitate and is commonly used in place of SDS. |
| General description: | N-Lauroylsarcosine sodium salt solution is an anionic surfactant which can be used in DNA extraction. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 512.6 °F |
| Flash Point(C) | 267 °C |
| Purity | 19-21% |
| UNSPSC | 12161900 |


