Synonym: 4-(N-Ethyl-n-4-hydroxybutyl)amino-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidine hydrochloride; NIH-3
CAS Number: 276890-57-4
Empirical Formula (Hill Notation): C24H35ClN4O
Molecular Weight: 431.01
MDL Number: MFCD07784506
Linear Formula: C24H35ClN4O
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
light brown |
| form |
solid |
| InChI |
1S/C24H34N4O.ClH/c1-8-27(11-9-10-12-29)23-21-18(5)19(6)28(24(21)26-20(7)25-23)22-16(3)13-15(2)14-17(22)4;/h13-14,29H,8-12H2,1-7H3;1H |
| InChI key |
DKVWSJKPRJIFPC-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
Cl[H].CCN(CCCCO)c1nc(C)nc2n(c(C)c(C)c12)-c3c(C)cc(C)cc3C |
| solubility |
DMSO: ~10 mg/mL |
| |
H2O: insoluble |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Non-peptide CRF1 corticotrophin-releasing factor antagonist. |
| Biochem/physiol Actions: |
Non-peptide CRF1 corticotrophin-releasing factor antagonist. Ki = 0.68 nM; blocks ethanol-induced effects as well as CRF effects in mice, suggesting a possible therapeutic target for the treatment of stress-induced alcohol drinking. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
