Synonym: 4-[2-(Methylthio)phenyl]-N-(1,2,3,4-tetrahydro-1-naphth alenyl)-1-piperazinehexanamide hydrochloride
CAS Number: 824958-12-5
Empirical Formula (Hill Notation): C27H38ClN3OS
Molecular Weight: 488.13
MDL Number: MFCD09971090
Linear Formula: C27H38ClN3OS
Product Type: Chemical
| assay |
≥98% (HPLC) |
| form |
solid |
| InChI |
1S/C27H37N3OS.ClH/c1-32-26-15-7-6-14-25(26)30-20-18-29(19-21-30)17-8-2-3-16-27(31)28-24-13-9-11-22-10-4-5-12-23(22)24;/h4-7,10,12,14-15,24H,2-3,8-9,11,13,16-21H2,1H3,(H,28,31);1H |
| InChI key |
DWGKCWWWKHCVDH-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
Cl.CSc1ccccc1N2CCN(CCCCCC(=O)NC3CCCc4ccccc34)CC2 |
| solubility |
DMSO: >10 mg/mL |
| |
H2O: ≥2 mg/mL |
| storage temp. |
2-8°C |
| Application: |
LP44 has been used as a 5-hydroxytryptamine (serotonin) receptor 7 (5-HT7) agonist to study its effects on mitochondria-mediated leucine-rich repeat and pyrin domain containing 3 (NLRP3) inflammasome activation. |
| Biochem/physiol Actions: |
LP44 is a high affinity 5-HT7 receptor agonist. |
| Biochem/physiol Actions: |
LP44 is a high affinity 5-HT7 receptor agonist. Ki = 0.22 nM. LP44 displays selectivity over 5-HT1A and 5-HT2A receptors (200- and >1000-fold, respectively). LP44 induces relaxation of substance P-stimulated guinea pig ileum (EC50 = 2.56 μM). |
| Packaging: |
10, 50 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
